C11H6FN3O5S — CID 116697344
2-[(3-fluoro-4-nitrophenyl)carbamoyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 116697344) has the molecular formula C11H6FN3O5S and a molecular weight of 311.25 g/mol. Its IUPAC name is 2-[(3-fluoro-4-nitrophenyl)carbamoyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(3-fluoro-4-nitrophenyl)carbamoyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116697344 |
| Molecular Formula | C11H6FN3O5S |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 2-[(3-fluoro-4-nitrophenyl)carbamoyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(C(=O)Nc2ccc([N+](=O)[O-])c(F)c2)n1 |
| InChI | InChI=1S/C11H6FN3O5S/c12-6-3-5(1-2-8(6)15(19)20)13-9(16)10-14-7(4-21-10)11(17)18/h1-4H,(H,13,16)(H,17,18) |
| InChIKey | JJRFPJDUEJDZCA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|