C10H12N2O3S — CID 116697444
2-[[(E)-pent-3-enyl]carbamoyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 116697444) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-[[(E)-pent-3-enyl]carbamoyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[(E)-pent-3-enyl]carbamoyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116697444 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2-[[(E)-pent-3-enyl]carbamoyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C/C=C/CCNC(=O)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C10H12N2O3S/c1-2-3-4-5-11-8(13)9-12-7(6-16-9)10(14)15/h2-3,6H,4-5H2,1H3,(H,11,13)(H,14,15)/b3-2+ |
| InChIKey | IYRSCCBXMWSDTK-NSCUHMNNSA-N |
| XLogP | 1.54 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|