C15H15FN2OS — CID 86952853
2-(4-fluorophenyl)-N-[(E)-pent-3-enyl]-1,3-thiazole-4-carboxamide (PubChem CID 86952853) has the molecular formula C15H15FN2OS and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(E)-pent-3-enyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(E)-pent-3-enyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 86952853 |
| Molecular Formula | C15H15FN2OS |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(E)-pent-3-enyl]-1,3-thiazole-4-carboxamide |
| SMILES | C/C=C/CCNC(=O)c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H15FN2OS/c1-2-3-4-9-17-14(19)13-10-20-15(18-13)11-5-7-12(16)8-6-11/h2-3,5-8,10H,4,9H2,1H3,(H,17,19)/b3-2+ |
| InChIKey | LMCVJNIGBBEMDP-NSCUHMNNSA-N |
| XLogP | 3.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|