C12H14ClF3N2 — CID 116700925
1-[3-chloro-5-(trifluoromethyl)phenyl]-3-methylpiperazine (PubChem CID 116700925) has the molecular formula C12H14ClF3N2 and a molecular weight of 278.70 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)phenyl]-3-methylpiperazine.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)phenyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 116700925 |
| Molecular Formula | C12H14ClF3N2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)phenyl]-3-methylpiperazine |
| SMILES | CC1CN(c2cc(Cl)cc(C(F)(F)F)c2)CCN1 |
| InChI | InChI=1S/C12H14ClF3N2/c1-8-7-18(3-2-17-8)11-5-9(12(14,15)16)4-10(13)6-11/h4-6,8,17H,2-3,7H2,1H3 |
| InChIKey | REHCZFVCZHYVMA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |