C14H16F6N2O — CID 86670311
1,1,1,3,3,3-hexafluoro-2-[4-[(3R)-3-methylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 86670311) has the molecular formula C14H16F6N2O and a molecular weight of 342.28 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[(3R)-3-methylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(3R)-3-methylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 86670311 |
| Molecular Formula | C14H16F6N2O |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(3R)-3-methylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | C[C@@H]1CN(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)CCN1 |
| InChI | InChI=1S/C14H16F6N2O/c1-9-8-22(7-6-21-9)11-4-2-10(3-5-11)12(23,13(15,16)17)14(18,19)20/h2-5,9,21,23H,6-8H2,1H3/t9-/m1/s1 |
| InChIKey | XFNAZJABIYOHRO-SECBINFHSA-N |
| XLogP | 2.80 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|