C8H11NO3S — CID 116705404
2-(1-methoxypropyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 116705404) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-(1-methoxypropyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(1-methoxypropyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 116705404 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2-(1-methoxypropyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CCC(OC)c1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C8H11NO3S/c1-3-5(12-2)7-9-4-6(13-7)8(10)11/h4-5H,3H2,1-2H3,(H,10,11) |
| InChIKey | ORTOTNKKZGCXIL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |