C8H10BrNO4S — CID 171891767
2-(4-bromo-1,2-dihydroxybutyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 171891767) has the molecular formula C8H10BrNO4S and a molecular weight of 296.14 g/mol. Its IUPAC name is 2-(4-bromo-1,2-dihydroxybutyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(4-bromo-1,2-dihydroxybutyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 171891767 |
| Molecular Formula | C8H10BrNO4S |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 294.95 |
| IUPAC Name | 2-(4-bromo-1,2-dihydroxybutyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(C(O)C(O)CCBr)s1 |
| InChI | InChI=1S/C8H10BrNO4S/c9-2-1-4(11)6(12)7-10-3-5(15-7)8(13)14/h3-4,6,11-12H,1-2H2,(H,13,14) |
| InChIKey | PTRYJTOXGGZYON-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|