C15H24O2 — CID 116710908
3-methoxy-1-(2,4,6-trimethylphenyl)pentan-2-ol (PubChem CID 116710908) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 3-methoxy-1-(2,4,6-trimethylphenyl)pentan-2-ol.
| Compound Name | 3-methoxy-1-(2,4,6-trimethylphenyl)pentan-2-ol |
|---|---|
| PubChem CID | 116710908 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-methoxy-1-(2,4,6-trimethylphenyl)pentan-2-ol |
| SMILES | CCC(OC)C(O)Cc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H24O2/c1-6-15(17-5)14(16)9-13-11(3)7-10(2)8-12(13)4/h7-8,14-16H,6,9H2,1-5H3 |
| InChIKey | PWHAQLGLXYZPQN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |