C15H24O2 — CID 146004844
2-(2,2-diethoxyethyl)-1,3,5-trimethylbenzene (PubChem CID 146004844) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyl)-1,3,5-trimethylbenzene.
| Compound Name | 2-(2,2-diethoxyethyl)-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 146004844 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-(2,2-diethoxyethyl)-1,3,5-trimethylbenzene |
| SMILES | CCOC(Cc1c(C)cc(C)cc1C)OCC |
| InChI | InChI=1S/C15H24O2/c1-6-16-15(17-7-2)10-14-12(4)8-11(3)9-13(14)5/h8-9,15H,6-7,10H2,1-5H3 |
| InChIKey | ZRNAKHIVHATHHS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|