C14H24NO2+ — CID 3845380
1-(2,2-diethoxyethyl)-2,4,6-trimethylpyridin-1-ium (PubChem CID 3845380) has the molecular formula C14H24NO2+ and a molecular weight of 238.35 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-2,4,6-trimethylpyridin-1-ium.
| Compound Name | 1-(2,2-diethoxyethyl)-2,4,6-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 3845380 |
| Molecular Formula | C14H24NO2+ |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-2,4,6-trimethylpyridin-1-ium |
| SMILES | CCOC(C[n+]1c(C)cc(C)cc1C)OCC |
| InChI | InChI=1S/C14H24NO2/c1-6-16-14(17-7-2)10-15-12(4)8-11(3)9-13(15)5/h8-9,14H,6-7,10H2,1-5H3/q+1 |
| InChIKey | HCCUGOGSBICXPR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|