C13H23N3O — CID 116718922
3-[3-methoxy-2-(methylamino)hexyl]pyridin-2-amine (PubChem CID 116718922) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-[3-methoxy-2-(methylamino)hexyl]pyridin-2-amine.
| Compound Name | 3-[3-methoxy-2-(methylamino)hexyl]pyridin-2-amine |
|---|---|
| PubChem CID | 116718922 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3-[3-methoxy-2-(methylamino)hexyl]pyridin-2-amine |
| SMILES | CCCC(OC)C(Cc1cccnc1N)NC |
| InChI | InChI=1S/C13H23N3O/c1-4-6-12(17-3)11(15-2)9-10-7-5-8-16-13(10)14/h5,7-8,11-12,15H,4,6,9H2,1-3H3,(H2,14,16) |
| InChIKey | MNVDHIDYOIEUOL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |