C52H74O6Si2 — CID 11672348
(3S,4R)-3,4-bis[(S)-(4-benzyl-3-methoxyphenyl)-tri(propan-2-yl)silyloxymethyl]oxolan-2-one (PubChem CID 11672348) has the molecular formula C52H74O6Si2 and a molecular weight of 851.33 g/mol. Its IUPAC name is (3S,4R)-3,4-bis[(S)-(4-benzyl-3-methoxyphenyl)-tri(propan-2-yl)silyloxymethyl]oxolan-2-one.
| Compound Name | (3S,4R)-3,4-bis[(S)-(4-benzyl-3-methoxyphenyl)-tri(propan-2-yl)silyloxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 11672348 |
| Molecular Formula | C52H74O6Si2 |
| Molecular Weight | 851.33 g/mol |
| Exact Mass | 850.50 |
| IUPAC Name | (3S,4R)-3,4-bis[(S)-(4-benzyl-3-methoxyphenyl)-tri(propan-2-yl)silyloxymethyl]oxolan-2-one |
| SMILES | COc1cc([C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]2COC(=O)[C@@H]2[C@H](O[Si](C(C)C)(C(C)C)C(C)C)c2ccc(Cc3ccccc3)c(OC)c2)ccc1Cc1ccccc1 |
| InChI | InChI=1S/C52H74O6Si2/c1-34(2)59(35(3)4,36(5)6)57-50(44-27-25-42(47(31-44)54-13)29-40-21-17-15-18-22-40)46-33-56-52(53)49(46)51(58-60(37(7)8,38(9)10)39(11)12)45-28-26-43(48(32-45)55-14)30-41-23-19-16-20-24-41/h15-28,31-32,34-39,46,49-51H,29-30,33H2,1-14H3/t46-,49-,50+,51+/m0/s1 |
| InChIKey | JSARFVKMTMMRLC-GODKVNQISA-N |
| XLogP | 13.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.33 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|