C16H27NO3 — CID 116725272
1-(3,4-dimethoxyphenyl)-2-ethoxy-3,3-dimethylbutan-1-amine (PubChem CID 116725272) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-ethoxy-3,3-dimethylbutan-1-amine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-ethoxy-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 116725272 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-ethoxy-3,3-dimethylbutan-1-amine |
| SMILES | CCOC(C(N)c1ccc(OC)c(OC)c1)C(C)(C)C |
| InChI | InChI=1S/C16H27NO3/c1-7-20-15(16(2,3)4)14(17)11-8-9-12(18-5)13(10-11)19-6/h8-10,14-15H,7,17H2,1-6H3 |
| InChIKey | DPXJFACWZPYSAZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |