C11H22N2O2 — CID 116732462
2-methoxy-3,3-dimethyl-1-morpholin-4-ylbutan-1-imine (PubChem CID 116732462) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-methoxy-3,3-dimethyl-1-morpholin-4-ylbutan-1-imine.
| Compound Name | 2-methoxy-3,3-dimethyl-1-morpholin-4-ylbutan-1-imine |
|---|---|
| PubChem CID | 116732462 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-methoxy-3,3-dimethyl-1-morpholin-4-ylbutan-1-imine |
| SMILES | [H]/N=C(/C(OC)C(C)(C)C)N1CCOCC1 |
| InChI | InChI=1S/C11H22N2O2/c1-11(2,3)9(14-4)10(12)13-5-7-15-8-6-13/h9,12H,5-8H2,1-4H3/b12-10- |
| InChIKey | QCRXRDMLMPWTFZ-BENRWUELSA-N |
| XLogP | 1.36 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|