C7H12ClN3O — CID 116734164
3-chloro-5-(1-methoxybutyl)-1H-1,2,4-triazole (PubChem CID 116734164) has the molecular formula C7H12ClN3O and a molecular weight of 189.65 g/mol. Its IUPAC name is 3-chloro-5-(1-methoxybutyl)-1H-1,2,4-triazole.
| Compound Name | 3-chloro-5-(1-methoxybutyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 116734164 |
| Molecular Formula | C7H12ClN3O |
| Molecular Weight | 189.65 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 3-chloro-5-(1-methoxybutyl)-1H-1,2,4-triazole |
| SMILES | CCCC(OC)c1nc(Cl)n[nH]1 |
| InChI | InChI=1S/C7H12ClN3O/c1-3-4-5(12-2)6-9-7(8)11-10-6/h5H,3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | QHEWVLROYSQBPZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.65 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |