C7H9ClN4O2S — CID 88775236
ethyl 3-amino-2-(3-chloro-1H-1,2,4-triazol-5-yl)-3-sulfanylidenepropanoate (PubChem CID 88775236) has the molecular formula C7H9ClN4O2S and a molecular weight of 248.69 g/mol. Its IUPAC name is ethyl 3-amino-2-(3-chloro-1H-1,2,4-triazol-5-yl)-3-sulfanylidenepropanoate.
| Compound Name | ethyl 3-amino-2-(3-chloro-1H-1,2,4-triazol-5-yl)-3-sulfanylidenepropanoate |
|---|---|
| PubChem CID | 88775236 |
| Molecular Formula | C7H9ClN4O2S |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | ethyl 3-amino-2-(3-chloro-1H-1,2,4-triazol-5-yl)-3-sulfanylidenepropanoate |
| SMILES | CCOC(=O)C(C(N)=S)c1nc(Cl)n[nH]1 |
| InChI | InChI=1S/C7H9ClN4O2S/c1-2-14-6(13)3(4(9)15)5-10-7(8)12-11-5/h3H,2H2,1H3,(H2,9,15)(H,10,11,12) |
| InChIKey | VTGCQYNDTXWWQP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|