C22H21ClN4O4 — CID 3112042
diethyl 2-[4-chloro-6-(N-phenylanilino)-1,3,5-triazin-2-yl]propanedioate (PubChem CID 3112042) has the molecular formula C22H21ClN4O4 and a molecular weight of 440.89 g/mol. Its IUPAC name is diethyl 2-[4-chloro-6-(N-phenylanilino)-1,3,5-triazin-2-yl]propanedioate.
| Compound Name | diethyl 2-[4-chloro-6-(N-phenylanilino)-1,3,5-triazin-2-yl]propanedioate |
|---|---|
| PubChem CID | 3112042 |
| Molecular Formula | C22H21ClN4O4 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | diethyl 2-[4-chloro-6-(N-phenylanilino)-1,3,5-triazin-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1nc(Cl)nc(N(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C22H21ClN4O4/c1-3-30-19(28)17(20(29)31-4-2)18-24-21(23)26-22(25-18)27(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17H,3-4H2,1-2H3 |
| InChIKey | ZDEZZMLIUTZJFT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|