C12H21NOS — CID 116734667
4-butan-2-yl-2-(1-ethoxypropyl)-1,3-thiazole (PubChem CID 116734667) has the molecular formula C12H21NOS and a molecular weight of 227.37 g/mol. Its IUPAC name is 4-butan-2-yl-2-(1-ethoxypropyl)-1,3-thiazole.
| Compound Name | 4-butan-2-yl-2-(1-ethoxypropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116734667 |
| Molecular Formula | C12H21NOS |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 4-butan-2-yl-2-(1-ethoxypropyl)-1,3-thiazole |
| SMILES | CCOC(CC)c1nc(C(C)CC)cs1 |
| InChI | InChI=1S/C12H21NOS/c1-5-9(4)10-8-15-12(13-10)11(6-2)14-7-3/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | YZXRGFFUPFWYBO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |