C11H19NO3S — CID 116705379
4-(dimethoxymethyl)-2-(1-ethoxypropyl)-1,3-thiazole (PubChem CID 116705379) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-(1-ethoxypropyl)-1,3-thiazole.
| Compound Name | 4-(dimethoxymethyl)-2-(1-ethoxypropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116705379 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 4-(dimethoxymethyl)-2-(1-ethoxypropyl)-1,3-thiazole |
| SMILES | CCOC(CC)c1nc(C(OC)OC)cs1 |
| InChI | InChI=1S/C11H19NO3S/c1-5-9(15-6-2)10-12-8(7-16-10)11(13-3)14-4/h7,9,11H,5-6H2,1-4H3 |
| InChIKey | HMLPYXSPVRDZBC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|