C9H15NO2S2 — CID 66056149
4-(dimethoxymethyl)-2-(ethylsulfanylmethyl)-1,3-thiazole (PubChem CID 66056149) has the molecular formula C9H15NO2S2 and a molecular weight of 233.36 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-(ethylsulfanylmethyl)-1,3-thiazole.
| Compound Name | 4-(dimethoxymethyl)-2-(ethylsulfanylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 66056149 |
| Molecular Formula | C9H15NO2S2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 4-(dimethoxymethyl)-2-(ethylsulfanylmethyl)-1,3-thiazole |
| SMILES | CCSCc1nc(C(OC)OC)cs1 |
| InChI | InChI=1S/C9H15NO2S2/c1-4-13-6-8-10-7(5-14-8)9(11-2)12-3/h5,9H,4,6H2,1-3H3 |
| InChIKey | BQXZTFFYVAVTRT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|