C11H19NO2S — CID 107512034
2-(1-ethoxybutyl)-4-(methoxymethyl)-1,3-thiazole (PubChem CID 107512034) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is 2-(1-ethoxybutyl)-4-(methoxymethyl)-1,3-thiazole.
| Compound Name | 2-(1-ethoxybutyl)-4-(methoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 107512034 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-(1-ethoxybutyl)-4-(methoxymethyl)-1,3-thiazole |
| SMILES | CCCC(OCC)c1nc(COC)cs1 |
| InChI | InChI=1S/C11H19NO2S/c1-4-6-10(14-5-2)11-12-9(7-13-3)8-15-11/h8,10H,4-7H2,1-3H3 |
| InChIKey | QHPOHEQMIBCTHP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |