C9H15NO3S — CID 66890594
[2-(diethoxymethyl)-1,3-thiazol-4-yl]methanol (PubChem CID 66890594) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is [2-(diethoxymethyl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-(diethoxymethyl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 66890594 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | [2-(diethoxymethyl)-1,3-thiazol-4-yl]methanol |
| SMILES | CCOC(OCC)c1nc(CO)cs1 |
| InChI | InChI=1S/C9H15NO3S/c1-3-12-9(13-4-2)8-10-7(5-11)6-14-8/h6,9,11H,3-5H2,1-2H3 |
| InChIKey | SPHHAELMKXBHMI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|