C11H18N4O2 — CID 116735154
2-amino-3-(1-cyclohexyltriazol-4-yl)propanoic acid (PubChem CID 116735154) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-amino-3-(1-cyclohexyltriazol-4-yl)propanoic acid.
| Compound Name | 2-amino-3-(1-cyclohexyltriazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 116735154 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-amino-3-(1-cyclohexyltriazol-4-yl)propanoic acid |
| SMILES | NC(Cc1cn(C2CCCCC2)nn1)C(=O)O |
| InChI | InChI=1S/C11H18N4O2/c12-10(11(16)17)6-8-7-15(14-13-8)9-4-2-1-3-5-9/h7,9-10H,1-6,12H2,(H,16,17) |
| InChIKey | RDKHJJPBHTYKDU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |