C15H18ClNOS — CID 116744336
4-(3-chloropropyl)-2-[ethoxy(phenyl)methyl]-1,3-thiazole (PubChem CID 116744336) has the molecular formula C15H18ClNOS and a molecular weight of 295.83 g/mol. Its IUPAC name is 4-(3-chloropropyl)-2-[ethoxy(phenyl)methyl]-1,3-thiazole.
| Compound Name | 4-(3-chloropropyl)-2-[ethoxy(phenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 116744336 |
| Molecular Formula | C15H18ClNOS |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-(3-chloropropyl)-2-[ethoxy(phenyl)methyl]-1,3-thiazole |
| SMILES | CCOC(c1ccccc1)c1nc(CCCCl)cs1 |
| InChI | InChI=1S/C15H18ClNOS/c1-2-18-14(12-7-4-3-5-8-12)15-17-13(11-19-15)9-6-10-16/h3-5,7-8,11,14H,2,6,9-10H2,1H3 |
| InChIKey | MUHBSCOHQXXFKJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|