C19H26O2 — CID 116749559
(4-cyclobutylphenyl)-(1-methoxy-3-methylcyclohexyl)methanone (PubChem CID 116749559) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (4-cyclobutylphenyl)-(1-methoxy-3-methylcyclohexyl)methanone.
| Compound Name | (4-cyclobutylphenyl)-(1-methoxy-3-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 116749559 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (4-cyclobutylphenyl)-(1-methoxy-3-methylcyclohexyl)methanone |
| SMILES | COC1(C(=O)c2ccc(C3CCC3)cc2)CCCC(C)C1 |
| InChI | InChI=1S/C19H26O2/c1-14-5-4-12-19(13-14,21-2)18(20)17-10-8-16(9-11-17)15-6-3-7-15/h8-11,14-15H,3-7,12-13H2,1-2H3 |
| InChIKey | DBQGIERRXRSRDX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |