C13H18O3 — CID 116749625
furan-3-yl-(1-methoxy-3-methylcyclohexyl)methanone (PubChem CID 116749625) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is furan-3-yl-(1-methoxy-3-methylcyclohexyl)methanone.
| Compound Name | furan-3-yl-(1-methoxy-3-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 116749625 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | furan-3-yl-(1-methoxy-3-methylcyclohexyl)methanone |
| SMILES | COC1(C(=O)c2ccoc2)CCCC(C)C1 |
| InChI | InChI=1S/C13H18O3/c1-10-4-3-6-13(8-10,15-2)12(14)11-5-7-16-9-11/h5,7,9-10H,3-4,6,8H2,1-2H3 |
| InChIKey | KDUOPIJRPPUTSS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |