C18H20O2 — CID 116751355
1-methoxy-1,5-diphenylpentan-2-one (PubChem CID 116751355) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-methoxy-1,5-diphenylpentan-2-one.
| Compound Name | 1-methoxy-1,5-diphenylpentan-2-one |
|---|---|
| PubChem CID | 116751355 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-methoxy-1,5-diphenylpentan-2-one |
| SMILES | COC(C(=O)CCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20O2/c1-20-18(16-12-6-3-7-13-16)17(19)14-8-11-15-9-4-2-5-10-15/h2-7,9-10,12-13,18H,8,11,14H2,1H3 |
| InChIKey | MKLCYHRJMGIEPR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |