C28H31NO5 — CID 139251059
[(2R)-1-[(2-methoxy-2-phenylacetyl)amino]-4-phenylbutan-2-yl] 2-methoxy-2-phenylacetate (PubChem CID 139251059) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is [(2R)-1-[(2-methoxy-2-phenylacetyl)amino]-4-phenylbutan-2-yl] 2-methoxy-2-phenylacetate.
| Compound Name | [(2R)-1-[(2-methoxy-2-phenylacetyl)amino]-4-phenylbutan-2-yl] 2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 139251059 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | [(2R)-1-[(2-methoxy-2-phenylacetyl)amino]-4-phenylbutan-2-yl] 2-methoxy-2-phenylacetate |
| SMILES | COC(C(=O)NC[C@@H](CCc1ccccc1)OC(=O)C(OC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31NO5/c1-32-25(22-14-8-4-9-15-22)27(30)29-20-24(19-18-21-12-6-3-7-13-21)34-28(31)26(33-2)23-16-10-5-11-17-23/h3-17,24-26H,18-20H2,1-2H3,(H,29,30)/t24-,25?,26?/m1/s1 |
| InChIKey | POJOIJLPLCJIAR-JDSVYEKJSA-N |
| XLogP | 4.42 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |