C17H28FNO2 — CID 116759257
2-ethoxy-1-(5-fluoro-2-methoxyphenyl)-2-methyl-N-propylbutan-1-amine (PubChem CID 116759257) has the molecular formula C17H28FNO2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 2-ethoxy-1-(5-fluoro-2-methoxyphenyl)-2-methyl-N-propylbutan-1-amine.
| Compound Name | 2-ethoxy-1-(5-fluoro-2-methoxyphenyl)-2-methyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 116759257 |
| Molecular Formula | C17H28FNO2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2-ethoxy-1-(5-fluoro-2-methoxyphenyl)-2-methyl-N-propylbutan-1-amine |
| SMILES | CCCNC(c1cc(F)ccc1OC)C(C)(CC)OCC |
| InChI | InChI=1S/C17H28FNO2/c1-6-11-19-16(17(4,7-2)21-8-3)14-12-13(18)9-10-15(14)20-5/h9-10,12,16,19H,6-8,11H2,1-5H3 |
| InChIKey | JTWLMNFJOPSJGJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |