C16H26FNOS — CID 82770576
N-[2-tert-butylsulfanyl-1-(5-fluoro-2-methoxyphenyl)ethyl]propan-1-amine (PubChem CID 82770576) has the molecular formula C16H26FNOS and a molecular weight of 299.46 g/mol. Its IUPAC name is N-[2-tert-butylsulfanyl-1-(5-fluoro-2-methoxyphenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-tert-butylsulfanyl-1-(5-fluoro-2-methoxyphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 82770576 |
| Molecular Formula | C16H26FNOS |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-[2-tert-butylsulfanyl-1-(5-fluoro-2-methoxyphenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CSC(C)(C)C)c1cc(F)ccc1OC |
| InChI | InChI=1S/C16H26FNOS/c1-6-9-18-14(11-20-16(2,3)4)13-10-12(17)7-8-15(13)19-5/h7-8,10,14,18H,6,9,11H2,1-5H3 |
| InChIKey | IXGHFCPJCGNWAR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |