C14H25NO2 — CID 116759332
2-ethoxy-1-(furan-3-yl)-2-methyl-N-propylbutan-1-amine (PubChem CID 116759332) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-ethoxy-1-(furan-3-yl)-2-methyl-N-propylbutan-1-amine.
| Compound Name | 2-ethoxy-1-(furan-3-yl)-2-methyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 116759332 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 2-ethoxy-1-(furan-3-yl)-2-methyl-N-propylbutan-1-amine |
| SMILES | CCCNC(c1ccoc1)C(C)(CC)OCC |
| InChI | InChI=1S/C14H25NO2/c1-5-9-15-13(12-8-10-16-11-12)14(4,6-2)17-7-3/h8,10-11,13,15H,5-7,9H2,1-4H3 |
| InChIKey | DBEBYEFYADQQKU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |