C16H26BrNO2 — CID 116759645
1-(5-bromo-2-methoxyphenyl)-3-ethoxy-3-ethylpentan-2-amine (PubChem CID 116759645) has the molecular formula C16H26BrNO2 and a molecular weight of 344.29 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-3-ethoxy-3-ethylpentan-2-amine.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-3-ethoxy-3-ethylpentan-2-amine |
|---|---|
| PubChem CID | 116759645 |
| Molecular Formula | C16H26BrNO2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-3-ethoxy-3-ethylpentan-2-amine |
| SMILES | CCOC(CC)(CC)C(N)Cc1cc(Br)ccc1OC |
| InChI | InChI=1S/C16H26BrNO2/c1-5-16(6-2,20-7-3)15(18)11-12-10-13(17)8-9-14(12)19-4/h8-10,15H,5-7,11,18H2,1-4H3 |
| InChIKey | CSZFTDYEZYIKNP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |