C19H26BN3O5S — CID 11676094
[(1R)-1-[[(2S,3R)-3-hydroxy-2-[(5-thiophen-2-ylpyridine-3-carbonyl)amino]butanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 11676094) has the molecular formula C19H26BN3O5S and a molecular weight of 419.31 g/mol. Its IUPAC name is [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(5-thiophen-2-ylpyridine-3-carbonyl)amino]butanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(5-thiophen-2-ylpyridine-3-carbonyl)amino]butanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 11676094 |
| Molecular Formula | C19H26BN3O5S |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(5-thiophen-2-ylpyridine-3-carbonyl)amino]butanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1cncc(-c2cccs2)c1)[C@@H](C)O)B(O)O |
| InChI | InChI=1S/C19H26BN3O5S/c1-11(2)7-16(20(27)28)22-19(26)17(12(3)24)23-18(25)14-8-13(9-21-10-14)15-5-4-6-29-15/h4-6,8-12,16-17,24,27-28H,7H2,1-3H3,(H,22,26)(H,23,25)/t12-,16+,17+/m1/s1 |
| InChIKey | GGDQXXRHTXTQNX-DQYPLSBCSA-N |
| XLogP | 0.83 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|