C17H18INO6 — CID 11676942
(3'aR,5S,7'aR)-3-(3-iodo-4-methylphenyl)-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-2,7'-dione (PubChem CID 11676942) has the molecular formula C17H18INO6 and a molecular weight of 459.24 g/mol. Its IUPAC name is (3'aR,5S,7'aR)-3-(3-iodo-4-methylphenyl)-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-2,7'-dione.
| Compound Name | (3'aR,5S,7'aR)-3-(3-iodo-4-methylphenyl)-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-2,7'-dione |
|---|---|
| PubChem CID | 11676942 |
| Molecular Formula | C17H18INO6 |
| Molecular Weight | 459.24 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | (3'aR,5S,7'aR)-3-(3-iodo-4-methylphenyl)-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-2,7'-dione |
| SMILES | Cc1ccc(N2C[C@]3(OC[C@H]4OC(C)(C)O[C@H]4C3=O)OC2=O)cc1I |
| InChI | InChI=1S/C17H18INO6/c1-9-4-5-10(6-11(9)18)19-8-17(25-15(19)21)14(20)13-12(7-22-17)23-16(2,3)24-13/h4-6,12-13H,7-8H2,1-3H3/t12-,13-,17+/m1/s1 |
| InChIKey | SVMDAWNNINIRLQ-XNJGSVPQSA-N |
| XLogP | 2.37 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|