C11H14O6 — CID 58766047
(3aR,6S)-2,2-dimethylspiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,5'-oxolane]-2',7-dione (PubChem CID 58766047) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is (3aR,6S)-2,2-dimethylspiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,5'-oxolane]-2',7-dione.
| Compound Name | (3aR,6S)-2,2-dimethylspiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,5'-oxolane]-2',7-dione |
|---|---|
| PubChem CID | 58766047 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (3aR,6S)-2,2-dimethylspiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,5'-oxolane]-2',7-dione |
| SMILES | CC1(C)OC2C(=O)[C@@]3(CCC(=O)O3)OC[C@H]2O1 |
| InChI | InChI=1S/C11H14O6/c1-10(2)15-6-5-14-11(4-3-7(12)16-11)9(13)8(6)17-10/h6,8H,3-5H2,1-2H3/t6-,8?,11+/m1/s1 |
| InChIKey | JAEVIOHPDBRJLJ-TVBDUNCESA-N |
| XLogP | 0.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |