C10H15NO2S — CID 116774185
1-[2-(2-methoxybutan-2-yl)-1,3-thiazol-4-yl]ethanone (PubChem CID 116774185) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 1-[2-(2-methoxybutan-2-yl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(2-methoxybutan-2-yl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 116774185 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-[2-(2-methoxybutan-2-yl)-1,3-thiazol-4-yl]ethanone |
| SMILES | CCC(C)(OC)c1nc(C(C)=O)cs1 |
| InChI | InChI=1S/C10H15NO2S/c1-5-10(3,13-4)9-11-8(6-14-9)7(2)12/h6H,5H2,1-4H3 |
| InChIKey | REEKQUOOQUGHTM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |