C10H15NO3S — CID 116744386
2-(3-methoxypentan-3-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 116744386) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-(3-methoxypentan-3-yl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(3-methoxypentan-3-yl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116744386 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 2-(3-methoxypentan-3-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | CCC(CC)(OC)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C10H15NO3S/c1-4-10(5-2,14-3)9-11-7(6-15-9)8(12)13/h6H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | HTYANNQZBYEPNJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |