C11H20N2OS — CID 116774571
1-[2-(3-methoxypentan-3-yl)-1,3-thiazol-4-yl]ethanamine (PubChem CID 116774571) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 1-[2-(3-methoxypentan-3-yl)-1,3-thiazol-4-yl]ethanamine.
| Compound Name | 1-[2-(3-methoxypentan-3-yl)-1,3-thiazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 116774571 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-[2-(3-methoxypentan-3-yl)-1,3-thiazol-4-yl]ethanamine |
| SMILES | CCC(CC)(OC)c1nc(C(C)N)cs1 |
| InChI | InChI=1S/C11H20N2OS/c1-5-11(6-2,14-4)10-13-9(7-15-10)8(3)12/h7-8H,5-6,12H2,1-4H3 |
| InChIKey | STASLYNAQPTHAH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |