C12H20IN3O — CID 116777127
N-ethyl-5-iodo-2-(3-methoxypentan-3-yl)pyrimidin-4-amine (PubChem CID 116777127) has the molecular formula C12H20IN3O and a molecular weight of 349.22 g/mol. Its IUPAC name is N-ethyl-5-iodo-2-(3-methoxypentan-3-yl)pyrimidin-4-amine.
| Compound Name | N-ethyl-5-iodo-2-(3-methoxypentan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 116777127 |
| Molecular Formula | C12H20IN3O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-ethyl-5-iodo-2-(3-methoxypentan-3-yl)pyrimidin-4-amine |
| SMILES | CCNc1nc(C(CC)(CC)OC)ncc1I |
| InChI | InChI=1S/C12H20IN3O/c1-5-12(6-2,17-4)11-15-8-9(13)10(16-11)14-7-3/h8H,5-7H2,1-4H3,(H,14,15,16) |
| InChIKey | CRZSLGKJEFVPSW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|