C15H28N4O — CID 116777561
[6-tert-butyl-2-(3-ethoxypentan-3-yl)pyrimidin-4-yl]hydrazine (PubChem CID 116777561) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is [6-tert-butyl-2-(3-ethoxypentan-3-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-tert-butyl-2-(3-ethoxypentan-3-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 116777561 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | [6-tert-butyl-2-(3-ethoxypentan-3-yl)pyrimidin-4-yl]hydrazine |
| SMILES | CCOC(CC)(CC)c1nc(NN)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H28N4O/c1-7-15(8-2,20-9-3)13-17-11(14(4,5)6)10-12(18-13)19-16/h10H,7-9,16H2,1-6H3,(H,17,18,19) |
| InChIKey | NDDKUQFGQJIREN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|