C13H10ClN5O — CID 116794626
5-amino-N-(2-chloropyrimidin-4-yl)-1H-indole-2-carboxamide (PubChem CID 116794626) has the molecular formula C13H10ClN5O and a molecular weight of 287.71 g/mol. Its IUPAC name is 5-amino-N-(2-chloropyrimidin-4-yl)-1H-indole-2-carboxamide.
| Compound Name | 5-amino-N-(2-chloropyrimidin-4-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 116794626 |
| Molecular Formula | C13H10ClN5O |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-amino-N-(2-chloropyrimidin-4-yl)-1H-indole-2-carboxamide |
| SMILES | Nc1ccc2[nH]c(C(=O)Nc3ccnc(Cl)n3)cc2c1 |
| InChI | InChI=1S/C13H10ClN5O/c14-13-16-4-3-11(19-13)18-12(20)10-6-7-5-8(15)1-2-9(7)17-10/h1-6,17H,15H2,(H,16,18,19,20) |
| InChIKey | AIBRUXMVNRRNIN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|