C10H15BrN4 — CID 116797521
6-bromo-2-(2,4-dimethylpyrrolidin-1-yl)pyrimidin-4-amine (PubChem CID 116797521) has the molecular formula C10H15BrN4 and a molecular weight of 271.16 g/mol. Its IUPAC name is 6-bromo-2-(2,4-dimethylpyrrolidin-1-yl)pyrimidin-4-amine.
| Compound Name | 6-bromo-2-(2,4-dimethylpyrrolidin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 116797521 |
| Molecular Formula | C10H15BrN4 |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 6-bromo-2-(2,4-dimethylpyrrolidin-1-yl)pyrimidin-4-amine |
| SMILES | CC1CC(C)N(c2nc(N)cc(Br)n2)C1 |
| InChI | InChI=1S/C10H15BrN4/c1-6-3-7(2)15(5-6)10-13-8(11)4-9(12)14-10/h4,6-7H,3,5H2,1-2H3,(H2,12,13,14) |
| InChIKey | LVTPNTDKTAIJCV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |