C9H11N5S — CID 116798270
2-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine (PubChem CID 116798270) has the molecular formula C9H11N5S and a molecular weight of 221.29 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine.
| Compound Name | 2-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116798270 |
| Molecular Formula | C9H11N5S |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine |
| SMILES | Cc1cc(Sc2nccc(N)n2)n(C)n1 |
| InChI | InChI=1S/C9H11N5S/c1-6-5-8(14(2)13-6)15-9-11-4-3-7(10)12-9/h3-5H,1-2H3,(H2,10,11,12) |
| InChIKey | IZSOPDXZSFVRKT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |