C10H12N4 — CID 116799236
2-(2,4-dimethylphenyl)triazol-4-amine (PubChem CID 116799236) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)triazol-4-amine.
| Compound Name | 2-(2,4-dimethylphenyl)triazol-4-amine |
|---|---|
| PubChem CID | 116799236 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 2-(2,4-dimethylphenyl)triazol-4-amine |
| SMILES | Cc1ccc(-n2ncc(N)n2)c(C)c1 |
| InChI | InChI=1S/C10H12N4/c1-7-3-4-9(8(2)5-7)14-12-6-10(11)13-14/h3-6H,1-2H3,(H2,11,13) |
| InChIKey | NJYVSZLMUZAWTP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |