C12H15N3 — CID 60865980
1-(2,4-dimethylphenyl)-5-methylpyrazol-4-amine (PubChem CID 60865980) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-5-methylpyrazol-4-amine.
| Compound Name | 1-(2,4-dimethylphenyl)-5-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 60865980 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-5-methylpyrazol-4-amine |
| SMILES | Cc1ccc(-n2ncc(N)c2C)c(C)c1 |
| InChI | InChI=1S/C12H15N3/c1-8-4-5-12(9(2)6-8)15-10(3)11(13)7-14-15/h4-7H,13H2,1-3H3 |
| InChIKey | LKVIRGABVLXLGA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |