C14H14N4OS — CID 82528544
5-[1-(2,4-dimethylphenyl)-5-methylpyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82528544) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is 5-[1-(2,4-dimethylphenyl)-5-methylpyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[1-(2,4-dimethylphenyl)-5-methylpyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82528544 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 5-[1-(2,4-dimethylphenyl)-5-methylpyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1ccc(-n2ncc(-c3n[nH]c(=S)o3)c2C)c(C)c1 |
| InChI | InChI=1S/C14H14N4OS/c1-8-4-5-12(9(2)6-8)18-10(3)11(7-15-18)13-16-17-14(20)19-13/h4-7H,1-3H3,(H,17,20) |
| InChIKey | WXWZVVVDPDWOAY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|