C19H20O2 — CID 11680726
1-(cyclobuten-1-yl)-3-methoxy-2-[(2-methylphenyl)methoxy]benzene (PubChem CID 11680726) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(cyclobuten-1-yl)-3-methoxy-2-[(2-methylphenyl)methoxy]benzene.
| Compound Name | 1-(cyclobuten-1-yl)-3-methoxy-2-[(2-methylphenyl)methoxy]benzene |
|---|---|
| PubChem CID | 11680726 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-(cyclobuten-1-yl)-3-methoxy-2-[(2-methylphenyl)methoxy]benzene |
| SMILES | COc1cccc(C2=CCC2)c1OCc1ccccc1C |
| InChI | InChI=1S/C19H20O2/c1-14-7-3-4-8-16(14)13-21-19-17(15-9-5-10-15)11-6-12-18(19)20-2/h3-4,6-9,11-12H,5,10,13H2,1-2H3 |
| InChIKey | NFNGKAHORNASLC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |