C15H27N3O4 — CID 11681185
N-[[(4S)-3,15-dioxo-1,2-diazacyclopentadec-4-yl]methyl]-N-hydroxyformamide (PubChem CID 11681185) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[[(4S)-3,15-dioxo-1,2-diazacyclopentadec-4-yl]methyl]-N-hydroxyformamide.
| Compound Name | N-[[(4S)-3,15-dioxo-1,2-diazacyclopentadec-4-yl]methyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 11681185 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | N-[[(4S)-3,15-dioxo-1,2-diazacyclopentadec-4-yl]methyl]-N-hydroxyformamide |
| SMILES | O=CN(O)C[C@@H]1CCCCCCCCCCC(=O)NNC1=O |
| InChI | InChI=1S/C15H27N3O4/c19-12-18(22)11-13-9-7-5-3-1-2-4-6-8-10-14(20)16-17-15(13)21/h12-13,22H,1-11H2,(H,16,20)(H,17,21)/t13-/m0/s1 |
| InChIKey | NCACQBHLUJICJN-ZDUSSCGKSA-N |
| XLogP | 1.51 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|