About 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine
5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine (PubChem CID 116812054) has the molecular formula C13H16N2S
and a molecular weight of 232.35 g/mol. Its IUPAC name is 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine |
| PubChem CID | 116812054 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(-c2cc(C)ccc2C)s1 |
| InChI | InChI=1S/C13H16N2S/c1-4-14-13-15-8-12(16-13)11-7-9(2)5-6-10(11)3/h5-8H,4H2,1-3H3,(H,14,15) |
| InChIKey | PWDLYQRHORLXHJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine?
The IUPAC name of 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine (CID 116812054) is 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine is CCNc1ncc(-c2cc(C)ccc2C)s1.
What is the InChIKey of 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine?
The InChIKey is PWDLYQRHORLXHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2S/c1-4-14-13-15-8-12(16-13)11-7-9(2)5-6-10(11)3/h5-8H,4H2,1-3H3,(H,14,15).
What are the key properties of 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine?
5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine has a molecular weight of 232.35 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dimethylphenyl)-N-ethyl-1,3-thiazol-2-amine is sourced from PubChem (CID 116812054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).