C11H10F2N2S — CID 116811974
5-(2,4-difluorophenyl)-N-ethyl-1,3-thiazol-2-amine (PubChem CID 116811974) has the molecular formula C11H10F2N2S and a molecular weight of 240.28 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-N-ethyl-1,3-thiazol-2-amine.
| Compound Name | 5-(2,4-difluorophenyl)-N-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 116811974 |
| Molecular Formula | C11H10F2N2S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 5-(2,4-difluorophenyl)-N-ethyl-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(-c2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C11H10F2N2S/c1-2-14-11-15-6-10(16-11)8-4-3-7(12)5-9(8)13/h3-6H,2H2,1H3,(H,14,15) |
| InChIKey | UYMBDQIWVPBLEP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |